C19H18N4O3 — CID 16898262
2-benzyl-8-(4-methoxyphenyl)-6,7-dihydroimidazo[2,1-c][1,2,4]triazine-3,4-dione (PubChem CID 16898262) has the molecular formula C19H18N4O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is 2-benzyl-8-(4-methoxyphenyl)-6,7-dihydroimidazo[2,1-c][1,2,4]triazine-3,4-dione.
| Compound Name | 2-benzyl-8-(4-methoxyphenyl)-6,7-dihydroimidazo[2,1-c][1,2,4]triazine-3,4-dione |
|---|---|
| PubChem CID | 16898262 |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 2-benzyl-8-(4-methoxyphenyl)-6,7-dihydroimidazo[2,1-c][1,2,4]triazine-3,4-dione |
| SMILES | COc1ccc(N2CCn3c2nn(Cc2ccccc2)c(=O)c3=O)cc1 |
| InChI | InChI=1S/C19H18N4O3/c1-26-16-9-7-15(8-10-16)21-11-12-22-17(24)18(25)23(20-19(21)22)13-14-5-3-2-4-6-14/h2-10H,11-13H2,1H3 |
| InChIKey | DHPYITGJLBYOCW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 69.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|