C17H28N2O4 — CID 168983254
tert-butyl (4S)-2,4-dimethyl-3-prop-2-enoyl-1-oxa-3,8-diazaspiro[4.5]decane-8-carboxylate (PubChem CID 168983254) has the molecular formula C17H28N2O4 and a molecular weight of 324.42 g/mol. Its IUPAC name is tert-butyl (4S)-2,4-dimethyl-3-prop-2-enoyl-1-oxa-3,8-diazaspiro[4.5]decane-8-carboxylate.
| Compound Name | tert-butyl (4S)-2,4-dimethyl-3-prop-2-enoyl-1-oxa-3,8-diazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 168983254 |
| Molecular Formula | C17H28N2O4 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | tert-butyl (4S)-2,4-dimethyl-3-prop-2-enoyl-1-oxa-3,8-diazaspiro[4.5]decane-8-carboxylate |
| SMILES | C=CC(=O)N1C(C)OC2(CCN(C(=O)OC(C)(C)C)CC2)[C@@H]1C |
| InChI | InChI=1S/C17H28N2O4/c1-7-14(20)19-12(2)17(22-13(19)3)8-10-18(11-9-17)15(21)23-16(4,5)6/h7,12-13H,1,8-11H2,2-6H3/t12-,13?/m0/s1 |
| InChIKey | ZEVJGZMCFZBDKI-UEWDXFNNSA-N |
| XLogP | 2.54 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|