C19H27N — CID 168983862
5-[(1Z)-buta-1,3-dienyl]-6-methyl-4-propan-2-yl-2,3-dihydroquinoline;ethane (PubChem CID 168983862) has the molecular formula C19H27N and a molecular weight of 269.43 g/mol. Its IUPAC name is 5-[(1Z)-buta-1,3-dienyl]-6-methyl-4-propan-2-yl-2,3-dihydroquinoline;ethane.
| Compound Name | 5-[(1Z)-buta-1,3-dienyl]-6-methyl-4-propan-2-yl-2,3-dihydroquinoline;ethane |
|---|---|
| PubChem CID | 168983862 |
| Molecular Formula | C19H27N |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | 5-[(1Z)-buta-1,3-dienyl]-6-methyl-4-propan-2-yl-2,3-dihydroquinoline;ethane |
| SMILES | C=C/C=C\c1c(C)ccc2c1=C(C(C)C)CCN=2.CC |
| InChI | InChI=1S/C17H21N.C2H6/c1-5-6-7-15-13(4)8-9-16-17(15)14(12(2)3)10-11-18-16;1-2/h5-9,12H,1,10-11H2,2-4H3;1-2H3/b7-6-; |
| InChIKey | PBEBWORXZNBDLP-NAFXZHHSSA-N |
| XLogP | 4.05 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|