C12H11BrFNO — CID 168984402
7-(bromomethyl)-3-ethyl-8-fluoro-1H-quinolin-2-one (PubChem CID 168984402) has the molecular formula C12H11BrFNO and a molecular weight of 284.13 g/mol. Its IUPAC name is 7-(bromomethyl)-3-ethyl-8-fluoro-1H-quinolin-2-one.
| Compound Name | 7-(bromomethyl)-3-ethyl-8-fluoro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 168984402 |
| Molecular Formula | C12H11BrFNO |
| Molecular Weight | 284.13 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | 7-(bromomethyl)-3-ethyl-8-fluoro-1H-quinolin-2-one |
| SMILES | CCc1cc2ccc(CBr)c(F)c2[nH]c1=O |
| InChI | InChI=1S/C12H11BrFNO/c1-2-7-5-8-3-4-9(6-13)10(14)11(8)15-12(7)16/h3-5H,2,6H2,1H3,(H,15,16) |
| InChIKey | VSWLLCISCHXIKY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.13 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|