C25H28N6O3 — CID 168984419
N-methyl-5-[(1R,6S)-5-[(6-oxo-5,8,9,10-tetrahydropyrano[2,3-c][1,5]naphthyridin-3-yl)methyl]-2,5-diazabicyclo[4.2.0]octan-2-yl]pyridine-2-carboxamide (PubChem CID 168984419) has the molecular formula C25H28N6O3 and a molecular weight of 460.54 g/mol. Its IUPAC name is N-methyl-5-[(1R,6S)-5-[(6-oxo-5,8,9,10-tetrahydropyrano[2,3-c][1,5]naphthyridin-3-yl)methyl]-2,5-diazabicyclo[4.2.0]octan-2-yl]pyridine-2-carboxamide.
| Compound Name | N-methyl-5-[(1R,6S)-5-[(6-oxo-5,8,9,10-tetrahydropyrano[2,3-c][1,5]naphthyridin-3-yl)methyl]-2,5-diazabicyclo[4.2.0]octan-2-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 168984419 |
| Molecular Formula | C25H28N6O3 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | N-methyl-5-[(1R,6S)-5-[(6-oxo-5,8,9,10-tetrahydropyrano[2,3-c][1,5]naphthyridin-3-yl)methyl]-2,5-diazabicyclo[4.2.0]octan-2-yl]pyridine-2-carboxamide |
| SMILES | CNC(=O)c1ccc(N2CCN(Cc3cnc4c5c(c(=O)[nH]c4c3)OCCC5)[C@H]3CC[C@H]32)cn1 |
| InChI | InChI=1S/C25H28N6O3/c1-26-24(32)18-5-4-16(13-27-18)31-9-8-30(20-6-7-21(20)31)14-15-11-19-22(28-12-15)17-3-2-10-34-23(17)25(33)29-19/h4-5,11-13,20-21H,2-3,6-10,14H2,1H3,(H,26,32)(H,29,33)/t20-,21+/m0/s1 |
| InChIKey | NVELEVIIIBFNQK-LEWJYISDSA-N |
| XLogP | 1.86 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |