C68H131NO10U — CID 168985511
hexyl 2-octyldecanoate;2-[5-[2-[2-[6-(2-octyldecanoyloxy)hexoxy]propoxy]ethoxy]pentoxy]ethyl 1,4-dimethylpiperidine-4-carboxylate;uranium(2+) (PubChem CID 168985511) has the molecular formula C68H131NO10U and a molecular weight of 1360.82 g/mol. Its IUPAC name is hexyl 2-octyldecanoate;2-[5-[2-[2-[6-(2-octyldecanoyloxy)hexoxy]propoxy]ethoxy]pentoxy]ethyl 1,4-dimethylpiperidine-4-carboxylate;uranium(2+).
| Compound Name | hexyl 2-octyldecanoate;2-[5-[2-[2-[6-(2-octyldecanoyloxy)hexoxy]propoxy]ethoxy]pentoxy]ethyl 1,4-dimethylpiperidine-4-carboxylate;uranium(2+) |
|---|---|
| PubChem CID | 168985511 |
| Molecular Formula | C68H131NO10U |
| Molecular Weight | 1360.82 g/mol |
| Exact Mass | 1360.03 |
| IUPAC Name | hexyl 2-octyldecanoate;2-[5-[2-[2-[6-(2-octyldecanoyloxy)hexoxy]propoxy]ethoxy]pentoxy]ethyl 1,4-dimethylpiperidine-4-carboxylate;uranium(2+) |
| SMILES | [CH2-]C(COCCOCCCCCOCCOC(=O)C1(C)CCN(C)CC1)OCCCCCCOC(=O)C(CCCCCCCC)CCCCCCCC.[CH2-]CCCCCOC(=O)C(CCCCCCCC)CCCCCCCC.[U+2] |
| InChI | InChI=1S/C44H84NO8.C24H47O2.U/c1-6-8-10-12-14-19-25-41(26-20-15-13-11-9-7-2)42(46)52-34-24-17-16-23-33-51-40(3)39-50-36-35-48-31-21-18-22-32-49-37-38-53-43(47)44(4)27-29-45(5)30-28-44;1-4-7-10-13-15-17-20-23(21-18-16-14-11-8-5-2)24(25)26-22-19-12-9-6-3;/h40-41H,3,6-39H2,1-2,4-5H3;23H,3-22H2,1-2H3;/q2*-1;+2 |
| InChIKey | GHQQKZQCOZUZND-UHFFFAOYSA-N |
| XLogP | 17.96 |
| TPSA | 119.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 58 |
| Heavy Atoms | 80 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1360.82 |
| LogP ≤ 5 | 17.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|