C21H21F5N2OS — CID 168986982
N-(3,3-difluorobutylsulfanyl)-5-[2-[4-(trifluoromethyl)phenoxy]ethyl]-1H-indol-3-amine (PubChem CID 168986982) has the molecular formula C21H21F5N2OS and a molecular weight of 444.47 g/mol. Its IUPAC name is N-(3,3-difluorobutylsulfanyl)-5-[2-[4-(trifluoromethyl)phenoxy]ethyl]-1H-indol-3-amine.
| Compound Name | N-(3,3-difluorobutylsulfanyl)-5-[2-[4-(trifluoromethyl)phenoxy]ethyl]-1H-indol-3-amine |
|---|---|
| PubChem CID | 168986982 |
| Molecular Formula | C21H21F5N2OS |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | N-(3,3-difluorobutylsulfanyl)-5-[2-[4-(trifluoromethyl)phenoxy]ethyl]-1H-indol-3-amine |
| SMILES | CC(F)(F)CCSNc1c[nH]c2ccc(CCOc3ccc(C(F)(F)F)cc3)cc12 |
| InChI | InChI=1S/C21H21F5N2OS/c1-20(22,23)9-11-30-28-19-13-27-18-7-2-14(12-17(18)19)8-10-29-16-5-3-15(4-6-16)21(24,25)26/h2-7,12-13,27-28H,8-11H2,1H3 |
| InChIKey | YUAHBPVEZPUMJQ-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|