C17H16ClF3N2O — CID 167468068
5-[2-[4-(trifluoromethyl)phenyl]ethoxy]-1H-indol-3-amine;hydrochloride (PubChem CID 167468068) has the molecular formula C17H16ClF3N2O and a molecular weight of 356.78 g/mol. Its IUPAC name is 5-[2-[4-(trifluoromethyl)phenyl]ethoxy]-1H-indol-3-amine;hydrochloride.
| Compound Name | 5-[2-[4-(trifluoromethyl)phenyl]ethoxy]-1H-indol-3-amine;hydrochloride |
|---|---|
| PubChem CID | 167468068 |
| Molecular Formula | C17H16ClF3N2O |
| Molecular Weight | 356.78 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 5-[2-[4-(trifluoromethyl)phenyl]ethoxy]-1H-indol-3-amine;hydrochloride |
| SMILES | Cl.Nc1c[nH]c2ccc(OCCc3ccc(C(F)(F)F)cc3)cc12 |
| InChI | InChI=1S/C17H15F3N2O.ClH/c18-17(19,20)12-3-1-11(2-4-12)7-8-23-13-5-6-16-14(9-13)15(21)10-22-16;/h1-6,9-10,22H,7-8,21H2;1H |
| InChIKey | KGEVCYACLRPQKN-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.78 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |