C23H25F4NO3SSi — CID 168987539
[3-cyano-7-fluoro-8-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-yl] trifluoromethanesulfonate (PubChem CID 168987539) has the molecular formula C23H25F4NO3SSi and a molecular weight of 499.60 g/mol. Its IUPAC name is [3-cyano-7-fluoro-8-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-yl] trifluoromethanesulfonate.
| Compound Name | [3-cyano-7-fluoro-8-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 168987539 |
| Molecular Formula | C23H25F4NO3SSi |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | [3-cyano-7-fluoro-8-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-yl] trifluoromethanesulfonate |
| SMILES | CC(C)[Si](C#Cc1c(F)ccc2cc(C#N)cc(OS(=O)(=O)C(F)(F)F)c12)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H25F4NO3SSi/c1-14(2)33(15(3)4,16(5)6)10-9-19-20(24)8-7-18-11-17(13-28)12-21(22(18)19)31-32(29,30)23(25,26)27/h7-8,11-12,14-16H,1-6H3 |
| InChIKey | ISELIIVUTNWOQQ-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|