C25H30F4O5SSi — CID 170902466
ethyl 6-fluoro-4-(trifluoromethylsulfonyloxy)-5-[2-tri(propan-2-yl)silylethynyl]naphthalene-2-carboxylate (PubChem CID 170902466) has the molecular formula C25H30F4O5SSi and a molecular weight of 546.66 g/mol. Its IUPAC name is ethyl 6-fluoro-4-(trifluoromethylsulfonyloxy)-5-[2-tri(propan-2-yl)silylethynyl]naphthalene-2-carboxylate.
| Compound Name | ethyl 6-fluoro-4-(trifluoromethylsulfonyloxy)-5-[2-tri(propan-2-yl)silylethynyl]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 170902466 |
| Molecular Formula | C25H30F4O5SSi |
| Molecular Weight | 546.66 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | ethyl 6-fluoro-4-(trifluoromethylsulfonyloxy)-5-[2-tri(propan-2-yl)silylethynyl]naphthalene-2-carboxylate |
| SMILES | CCOC(=O)c1cc(OS(=O)(=O)C(F)(F)F)c2c(C#C[Si](C(C)C)(C(C)C)C(C)C)c(F)ccc2c1 |
| InChI | InChI=1S/C25H30F4O5SSi/c1-8-33-24(30)19-13-18-9-10-21(26)20(11-12-36(15(2)3,16(4)5)17(6)7)23(18)22(14-19)34-35(31,32)25(27,28)29/h9-10,13-17H,8H2,1-7H3 |
| InChIKey | BOXGCGFJVINCAY-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.66 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|