C24H24F4N5OSSi — CID 168987798
CID 168987798 (PubChem CID 168987798) has the molecular formula C24H24F4N5OSSi and a molecular weight of 534.64 g/mol.
| Compound Name | CID 168987798 |
|---|---|
| PubChem CID | 168987798 |
| Molecular Formula | C24H24F4N5OSSi |
| Molecular Weight | 534.64 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | — |
| SMILES | CCn1cc(-c2c(F)cccc2[Si]2c3cc(C#N)sc3CN2C(=O)CCCN(C)C)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C24H24F4N5OSSi/c1-4-32-13-16(23(30-32)24(26,27)28)22-17(25)7-5-8-19(22)36-20-11-15(12-29)35-18(20)14-33(36)21(34)9-6-10-31(2)3/h5,7-8,11,13H,4,6,9-10,14H2,1-3H3 |
| InChIKey | FHBHNMQLEMKXCC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 65.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.64 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|