C22H27N3O3S2 — CID 16898845
N-[2-(cyclohexen-1-yl)ethyl]-2-[2-[2-(3-methoxyanilino)-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]acetamide (PubChem CID 16898845) has the molecular formula C22H27N3O3S2 and a molecular weight of 445.61 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[2-[2-(3-methoxyanilino)-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[2-[2-(3-methoxyanilino)-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 16898845 |
| Molecular Formula | C22H27N3O3S2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[2-[2-(3-methoxyanilino)-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]acetamide |
| SMILES | COc1cccc(NC(=O)CSc2nc(CC(=O)NCCC3=CCCCC3)cs2)c1 |
| InChI | InChI=1S/C22H27N3O3S2/c1-28-19-9-5-8-17(12-19)24-21(27)15-30-22-25-18(14-29-22)13-20(26)23-11-10-16-6-3-2-4-7-16/h5-6,8-9,12,14H,2-4,7,10-11,13,15H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | PKVGQGCXYHDJHG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|