C21H24N2O2S2 — CID 25284430
N-[2-(cyclohexen-1-yl)ethyl]-2-(2-phenacylsulfanyl-1,3-thiazol-4-yl)acetamide (PubChem CID 25284430) has the molecular formula C21H24N2O2S2 and a molecular weight of 400.57 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-(2-phenacylsulfanyl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(2-phenacylsulfanyl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 25284430 |
| Molecular Formula | C21H24N2O2S2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(2-phenacylsulfanyl-1,3-thiazol-4-yl)acetamide |
| SMILES | O=C(Cc1csc(SCC(=O)c2ccccc2)n1)NCCC1=CCCCC1 |
| InChI | InChI=1S/C21H24N2O2S2/c24-19(17-9-5-2-6-10-17)15-27-21-23-18(14-26-21)13-20(25)22-12-11-16-7-3-1-4-8-16/h2,5-7,9-10,14H,1,3-4,8,11-13,15H2,(H,22,25) |
| InChIKey | INJPXILABYOIHB-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|