C23H22F2N6O2 — CID 168988646
1-(2,6-difluorophenyl)-N-[3-methanimidoyl-4-(methylamino)-2-pyrrolidin-1-ylphenyl]-6-oxopyridazine-3-carboxamide (PubChem CID 168988646) has the molecular formula C23H22F2N6O2 and a molecular weight of 452.47 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-N-[3-methanimidoyl-4-(methylamino)-2-pyrrolidin-1-ylphenyl]-6-oxopyridazine-3-carboxamide.
| Compound Name | 1-(2,6-difluorophenyl)-N-[3-methanimidoyl-4-(methylamino)-2-pyrrolidin-1-ylphenyl]-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 168988646 |
| Molecular Formula | C23H22F2N6O2 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 1-(2,6-difluorophenyl)-N-[3-methanimidoyl-4-(methylamino)-2-pyrrolidin-1-ylphenyl]-6-oxopyridazine-3-carboxamide |
| SMILES | [H]/N=C/c1c(NC)ccc(NC(=O)c2ccc(=O)n(-c3c(F)cccc3F)n2)c1N1CCCC1 |
| InChI | InChI=1S/C23H22F2N6O2/c1-27-17-7-8-18(21(14(17)13-26)30-11-2-3-12-30)28-23(33)19-9-10-20(32)31(29-19)22-15(24)5-4-6-16(22)25/h4-10,13,26-27H,2-3,11-12H2,1H3,(H,28,33)/b26-13+ |
| InChIKey | QOQNFAXDWQUAGI-LGJNPRDNSA-N |
| XLogP | 3.40 |
| TPSA | 103.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|