C26H29F2N7O2 — CID 168988166
N-[4-amino-2-(4-aminopiperidin-1-yl)-3-(propan-2-yliminomethyl)phenyl]-1-(2,6-difluorophenyl)-6-oxopyridazine-3-carboxamide (PubChem CID 168988166) has the molecular formula C26H29F2N7O2 and a molecular weight of 509.56 g/mol. Its IUPAC name is N-[4-amino-2-(4-aminopiperidin-1-yl)-3-(propan-2-yliminomethyl)phenyl]-1-(2,6-difluorophenyl)-6-oxopyridazine-3-carboxamide.
| Compound Name | N-[4-amino-2-(4-aminopiperidin-1-yl)-3-(propan-2-yliminomethyl)phenyl]-1-(2,6-difluorophenyl)-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 168988166 |
| Molecular Formula | C26H29F2N7O2 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | N-[4-amino-2-(4-aminopiperidin-1-yl)-3-(propan-2-yliminomethyl)phenyl]-1-(2,6-difluorophenyl)-6-oxopyridazine-3-carboxamide |
| SMILES | CC(C)/N=C/c1c(N)ccc(NC(=O)c2ccc(=O)n(-c3c(F)cccc3F)n2)c1N1CCC(N)CC1 |
| InChI | InChI=1S/C26H29F2N7O2/c1-15(2)31-14-17-20(30)6-7-21(24(17)34-12-10-16(29)11-13-34)32-26(37)22-8-9-23(36)35(33-22)25-18(27)4-3-5-19(25)28/h3-9,14-16H,10-13,29-30H2,1-2H3,(H,32,37)/b31-14+ |
| InChIKey | ODUYXAJQPZGQON-XAZZYMPDSA-N |
| XLogP | 3.10 |
| TPSA | 131.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|