C29H36F2N6O2 — CID 168988138
N-[4-amino-3-(tert-butyliminomethyl)-2-(3-methylpyrrolidin-1-yl)phenyl]-1-(2,6-difluorophenyl)-6-oxopyridazine-3-carboxamide;ethane (PubChem CID 168988138) has the molecular formula C29H36F2N6O2 and a molecular weight of 538.64 g/mol. Its IUPAC name is N-[4-amino-3-(tert-butyliminomethyl)-2-(3-methylpyrrolidin-1-yl)phenyl]-1-(2,6-difluorophenyl)-6-oxopyridazine-3-carboxamide;ethane.
| Compound Name | N-[4-amino-3-(tert-butyliminomethyl)-2-(3-methylpyrrolidin-1-yl)phenyl]-1-(2,6-difluorophenyl)-6-oxopyridazine-3-carboxamide;ethane |
|---|---|
| PubChem CID | 168988138 |
| Molecular Formula | C29H36F2N6O2 |
| Molecular Weight | 538.64 g/mol |
| Exact Mass | 538.29 |
| IUPAC Name | N-[4-amino-3-(tert-butyliminomethyl)-2-(3-methylpyrrolidin-1-yl)phenyl]-1-(2,6-difluorophenyl)-6-oxopyridazine-3-carboxamide;ethane |
| SMILES | CC.CC1CCN(c2c(NC(=O)c3ccc(=O)n(-c4c(F)cccc4F)n3)ccc(N)c2/C=N/C(C)(C)C)C1 |
| InChI | InChI=1S/C27H30F2N6O2.C2H6/c1-16-12-13-34(15-16)24-17(14-31-27(2,3)4)20(30)8-9-21(24)32-26(37)22-10-11-23(36)35(33-22)25-18(28)6-5-7-19(25)29;1-2/h5-11,14,16H,12-13,15,30H2,1-4H3,(H,32,37);1-2H3/b31-14+; |
| InChIKey | WVHJZXRPPHKPKQ-NJKUOPELSA-N |
| XLogP | 5.43 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.64 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|