C29H31F5N6O2 — CID 168988896
N-[4-amino-2-[(3S)-3-methylpyrrolidin-1-yl]-3-(4,4,4-trifluorobutyliminomethyl)phenyl]-1-(2,6-difluorophenyl)-6-oxopyridazine-3-carboxamide;ethene (PubChem CID 168988896) has the molecular formula C29H31F5N6O2 and a molecular weight of 590.60 g/mol. Its IUPAC name is N-[4-amino-2-[(3S)-3-methylpyrrolidin-1-yl]-3-(4,4,4-trifluorobutyliminomethyl)phenyl]-1-(2,6-difluorophenyl)-6-oxopyridazine-3-carboxamide;ethene.
| Compound Name | N-[4-amino-2-[(3S)-3-methylpyrrolidin-1-yl]-3-(4,4,4-trifluorobutyliminomethyl)phenyl]-1-(2,6-difluorophenyl)-6-oxopyridazine-3-carboxamide;ethene |
|---|---|
| PubChem CID | 168988896 |
| Molecular Formula | C29H31F5N6O2 |
| Molecular Weight | 590.60 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | N-[4-amino-2-[(3S)-3-methylpyrrolidin-1-yl]-3-(4,4,4-trifluorobutyliminomethyl)phenyl]-1-(2,6-difluorophenyl)-6-oxopyridazine-3-carboxamide;ethene |
| SMILES | C=C.C[C@H]1CCN(c2c(NC(=O)c3ccc(=O)n(-c4c(F)cccc4F)n3)ccc(N)c2/C=N/CCCC(F)(F)F)C1 |
| InChI | InChI=1S/C27H27F5N6O2.C2H4/c1-16-10-13-37(15-16)24-17(14-34-12-3-11-27(30,31)32)20(33)6-7-21(24)35-26(40)22-8-9-23(39)38(36-22)25-18(28)4-2-5-19(25)29;1-2/h2,4-9,14,16H,3,10-13,15,33H2,1H3,(H,35,40);1-2H2/b34-14+;/t16-;/m0./s1 |
| InChIKey | NMQCMIVUKCTQLO-JWMZAWSJSA-N |
| XLogP | 5.76 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.60 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|