C27H30F2N6O2 — CID 168988139
N-[4-amino-3-(tert-butyliminomethyl)-2-(3-methylpyrrolidin-1-yl)phenyl]-1-(2,6-difluorophenyl)-6-oxopyridazine-3-carboxamide (PubChem CID 168988139) has the molecular formula C27H30F2N6O2 and a molecular weight of 508.57 g/mol. Its IUPAC name is N-[4-amino-3-(tert-butyliminomethyl)-2-(3-methylpyrrolidin-1-yl)phenyl]-1-(2,6-difluorophenyl)-6-oxopyridazine-3-carboxamide.
| Compound Name | N-[4-amino-3-(tert-butyliminomethyl)-2-(3-methylpyrrolidin-1-yl)phenyl]-1-(2,6-difluorophenyl)-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 168988139 |
| Molecular Formula | C27H30F2N6O2 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | N-[4-amino-3-(tert-butyliminomethyl)-2-(3-methylpyrrolidin-1-yl)phenyl]-1-(2,6-difluorophenyl)-6-oxopyridazine-3-carboxamide |
| SMILES | CC1CCN(c2c(NC(=O)c3ccc(=O)n(-c4c(F)cccc4F)n3)ccc(N)c2/C=N/C(C)(C)C)C1 |
| InChI | InChI=1S/C27H30F2N6O2/c1-16-12-13-34(15-16)24-17(14-31-27(2,3)4)20(30)8-9-21(24)32-26(37)22-10-11-23(36)35(33-22)25-18(28)6-5-7-19(25)29/h5-11,14,16H,12-13,15,30H2,1-4H3,(H,32,37)/b31-14+ |
| InChIKey | VFZKALIOSATZMU-XAZZYMPDSA-N |
| XLogP | 4.41 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|