C27H26KN6O- — CID 168991569
potassium;carbanide;1-[6-[6-(4-methylpenta-1,3-dienylamino)benzimidazol-1-yl]-2-(3-prop-1-ynylpyrazol-1-yl)-3-pyridinyl]ethanone (PubChem CID 168991569) has the molecular formula C27H26KN6O- and a molecular weight of 489.64 g/mol. Its IUPAC name is potassium;carbanide;1-[6-[6-(4-methylpenta-1,3-dienylamino)benzimidazol-1-yl]-2-(3-prop-1-ynylpyrazol-1-yl)-3-pyridinyl]ethanone.
| Compound Name | potassium;carbanide;1-[6-[6-(4-methylpenta-1,3-dienylamino)benzimidazol-1-yl]-2-(3-prop-1-ynylpyrazol-1-yl)-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 168991569 |
| Molecular Formula | C27H26KN6O- |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | potassium;carbanide;1-[6-[6-(4-methylpenta-1,3-dienylamino)benzimidazol-1-yl]-2-(3-prop-1-ynylpyrazol-1-yl)-3-pyridinyl]ethanone |
| SMILES | CC#Cc1ccn(-c2nc(-n3cnc4ccc(N/[C-]=C/C=C(C)C)cc43)ccc2C(C)=O)n1.[CH3-].[K+] |
| InChI | InChI=1S/C26H23N6O.CH3.K/c1-5-7-20-13-15-32(30-20)26-22(19(4)33)10-12-25(29-26)31-17-28-23-11-9-21(16-24(23)31)27-14-6-8-18(2)3;;/h6,8-13,15-17,27H,1-4H3;1H3;/q2*-1;+1 |
| InChIKey | WFUGUHIXSNLEIA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|