C29H31ClF2N6OS — CID 168996111
4-[6-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[prop-2-enyl(propyl)amino]quinazolin-7-yl]-7-fluoro-1,3-benzothiazol-2-amine (PubChem CID 168996111) has the molecular formula C29H31ClF2N6OS and a molecular weight of 585.12 g/mol. Its IUPAC name is 4-[6-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[prop-2-enyl(propyl)amino]quinazolin-7-yl]-7-fluoro-1,3-benzothiazol-2-amine.
| Compound Name | 4-[6-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[prop-2-enyl(propyl)amino]quinazolin-7-yl]-7-fluoro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 168996111 |
| Molecular Formula | C29H31ClF2N6OS |
| Molecular Weight | 585.12 g/mol |
| Exact Mass | 584.19 |
| IUPAC Name | 4-[6-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[prop-2-enyl(propyl)amino]quinazolin-7-yl]-7-fluoro-1,3-benzothiazol-2-amine |
| SMILES | C=CCN(CCC)c1nc(OCC23CCCN2CCC3)nc2c(F)c(-c3ccc(F)c4sc(N)nc34)c(Cl)cc12 |
| InChI | InChI=1S/C29H31ClF2N6OS/c1-3-11-37(12-4-2)26-18-15-19(30)21(17-7-8-20(31)25-24(17)34-27(33)40-25)22(32)23(18)35-28(36-26)39-16-29-9-5-13-38(29)14-6-10-29/h3,7-8,15H,1,4-6,9-14,16H2,2H3,(H2,33,34) |
| InChIKey | RGWPHBVGLZROJZ-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.12 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|