C15H22N2O — CID 168999163
3-methyl-2-[(2Z,4E)-3,4,5-trimethylhepta-2,4-dien-2-yl]pyrimidin-4-one (PubChem CID 168999163) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 3-methyl-2-[(2Z,4E)-3,4,5-trimethylhepta-2,4-dien-2-yl]pyrimidin-4-one.
| Compound Name | 3-methyl-2-[(2Z,4E)-3,4,5-trimethylhepta-2,4-dien-2-yl]pyrimidin-4-one |
|---|---|
| PubChem CID | 168999163 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 3-methyl-2-[(2Z,4E)-3,4,5-trimethylhepta-2,4-dien-2-yl]pyrimidin-4-one |
| SMILES | CC/C(C)=C(C)/C(C)=C(/C)c1nccc(=O)n1C |
| InChI | InChI=1S/C15H22N2O/c1-7-10(2)11(3)12(4)13(5)15-16-9-8-14(18)17(15)6/h8-9H,7H2,1-6H3/b11-10+,13-12- |
| InChIKey | IJEHGCMDSFAXRJ-MRBUWEIXSA-N |
| XLogP | 3.32 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|