C24H22F3N5O2 — CID 168999249
2-(methoxymethyl)-8-methyl-7-[3-(2,4,5-trifluorophenyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-6,7-dihydropyrimido[1,2-b]pyridazin-4-one (PubChem CID 168999249) has the molecular formula C24H22F3N5O2 and a molecular weight of 469.47 g/mol. Its IUPAC name is 2-(methoxymethyl)-8-methyl-7-[3-(2,4,5-trifluorophenyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-6,7-dihydropyrimido[1,2-b]pyridazin-4-one.
| Compound Name | 2-(methoxymethyl)-8-methyl-7-[3-(2,4,5-trifluorophenyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-6,7-dihydropyrimido[1,2-b]pyridazin-4-one |
|---|---|
| PubChem CID | 168999249 |
| Molecular Formula | C24H22F3N5O2 |
| Molecular Weight | 469.47 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | 2-(methoxymethyl)-8-methyl-7-[3-(2,4,5-trifluorophenyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-6,7-dihydropyrimido[1,2-b]pyridazin-4-one |
| SMILES | COCc1cc(=O)n2c(n1)C=C(C)C(N1CCc3ncc(-c4cc(F)c(F)cc4F)cc3C1)N2 |
| InChI | InChI=1S/C24H22F3N5O2/c1-13-5-22-29-16(12-34-2)7-23(33)32(22)30-24(13)31-4-3-21-15(11-31)6-14(10-28-21)17-8-19(26)20(27)9-18(17)25/h5-10,24,30H,3-4,11-12H2,1-2H3 |
| InChIKey | JPIYWAHYNXMZKU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|