C15H14Cl2N2OS2 — CID 16900185
2-[2-[(2,4-dichlorophenyl)methylsulfanyl]-1,3-thiazol-4-yl]-N-prop-2-enylacetamide (PubChem CID 16900185) has the molecular formula C15H14Cl2N2OS2 and a molecular weight of 373.33 g/mol. Its IUPAC name is 2-[2-[(2,4-dichlorophenyl)methylsulfanyl]-1,3-thiazol-4-yl]-N-prop-2-enylacetamide.
| Compound Name | 2-[2-[(2,4-dichlorophenyl)methylsulfanyl]-1,3-thiazol-4-yl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 16900185 |
| Molecular Formula | C15H14Cl2N2OS2 |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | 2-[2-[(2,4-dichlorophenyl)methylsulfanyl]-1,3-thiazol-4-yl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)Cc1csc(SCc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C15H14Cl2N2OS2/c1-2-5-18-14(20)7-12-9-22-15(19-12)21-8-10-3-4-11(16)6-13(10)17/h2-4,6,9H,1,5,7-8H2,(H,18,20) |
| InChIKey | YNPOJHVTHYZHME-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|