C14H13ClN2OS — CID 9399582
2-[2-(3-chlorophenyl)-1,3-thiazol-4-yl]-N-prop-2-enylacetamide (PubChem CID 9399582) has the molecular formula C14H13ClN2OS and a molecular weight of 292.79 g/mol. Its IUPAC name is 2-[2-(3-chlorophenyl)-1,3-thiazol-4-yl]-N-prop-2-enylacetamide.
| Compound Name | 2-[2-(3-chlorophenyl)-1,3-thiazol-4-yl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 9399582 |
| Molecular Formula | C14H13ClN2OS |
| Molecular Weight | 292.79 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 2-[2-(3-chlorophenyl)-1,3-thiazol-4-yl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)Cc1csc(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C14H13ClN2OS/c1-2-6-16-13(18)8-12-9-19-14(17-12)10-4-3-5-11(15)7-10/h2-5,7,9H,1,6,8H2,(H,16,18) |
| InChIKey | MGYBBIYSJHNYCT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.79 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|