C11H10N2O4 — CID 169002932
methyl 7-methoxy-1-oxido-1,5-naphthyridin-1-ium-4-carboxylate (PubChem CID 169002932) has the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. Its IUPAC name is methyl 7-methoxy-1-oxido-1,5-naphthyridin-1-ium-4-carboxylate.
| Compound Name | methyl 7-methoxy-1-oxido-1,5-naphthyridin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 169002932 |
| Molecular Formula | C11H10N2O4 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | methyl 7-methoxy-1-oxido-1,5-naphthyridin-1-ium-4-carboxylate |
| SMILES | COC(=O)c1cc[n+]([O-])c2cc(OC)cnc12 |
| InChI | InChI=1S/C11H10N2O4/c1-16-7-5-9-10(12-6-7)8(11(14)17-2)3-4-13(9)15/h3-6H,1-2H3 |
| InChIKey | SCVRCZDKVGVAEJ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 75.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|