C26H29ClF2N4O3Si — CID 169003719
(3S)-2-[[5-chloro-6-fluoro-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]methyl]-6-fluoro-1'-methylspiro[isoindole-3,3'-pyrrolidine]-1,2'-dione (PubChem CID 169003719) has the molecular formula C26H29ClF2N4O3Si and a molecular weight of 547.08 g/mol. Its IUPAC name is (3S)-2-[[5-chloro-6-fluoro-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]methyl]-6-fluoro-1'-methylspiro[isoindole-3,3'-pyrrolidine]-1,2'-dione.
| Compound Name | (3S)-2-[[5-chloro-6-fluoro-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]methyl]-6-fluoro-1'-methylspiro[isoindole-3,3'-pyrrolidine]-1,2'-dione |
|---|---|
| PubChem CID | 169003719 |
| Molecular Formula | C26H29ClF2N4O3Si |
| Molecular Weight | 547.08 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | (3S)-2-[[5-chloro-6-fluoro-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]methyl]-6-fluoro-1'-methylspiro[isoindole-3,3'-pyrrolidine]-1,2'-dione |
| SMILES | CN1CC[C@@]2(C1=O)c1ccc(F)cc1C(=O)N2Cc1cc2nc(Cl)c(F)cc2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C26H29ClF2N4O3Si/c1-31-8-7-26(25(31)35)19-6-5-16(28)11-18(19)24(34)33(26)14-17-12-21-22(13-20(29)23(27)30-21)32(17)15-36-9-10-37(2,3)4/h5-6,11-13H,7-10,14-15H2,1-4H3/t26-/m0/s1 |
| InChIKey | IGHVKEJTEZCHGH-SANMLTNESA-N |
| XLogP | 4.99 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.08 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|