C14H14BN3O4 — CID 169006320
[4-[(4-methoxypyrazolo[4,5-c]pyridin-1-yl)methyl]phenoxy]boronic acid (PubChem CID 169006320) has the molecular formula C14H14BN3O4 and a molecular weight of 299.10 g/mol. Its IUPAC name is [4-[(4-methoxypyrazolo[4,5-c]pyridin-1-yl)methyl]phenoxy]boronic acid.
| Compound Name | [4-[(4-methoxypyrazolo[4,5-c]pyridin-1-yl)methyl]phenoxy]boronic acid |
|---|---|
| PubChem CID | 169006320 |
| Molecular Formula | C14H14BN3O4 |
| Molecular Weight | 299.10 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | [4-[(4-methoxypyrazolo[4,5-c]pyridin-1-yl)methyl]phenoxy]boronic acid |
| SMILES | COc1nccc2c1cnn2Cc1ccc(OB(O)O)cc1 |
| InChI | InChI=1S/C14H14BN3O4/c1-21-14-12-8-17-18(13(12)6-7-16-14)9-10-2-4-11(5-3-10)22-15(19)20/h2-8,19-20H,9H2,1H3 |
| InChIKey | JNQMORWOLCMBGF-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.10 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|