C20H18N4O2 — CID 59398527
4-[1-[(4-methoxyphenyl)methyl]pyrazolo[3,4-b]pyridin-4-yl]oxyaniline (PubChem CID 59398527) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is 4-[1-[(4-methoxyphenyl)methyl]pyrazolo[3,4-b]pyridin-4-yl]oxyaniline.
| Compound Name | 4-[1-[(4-methoxyphenyl)methyl]pyrazolo[3,4-b]pyridin-4-yl]oxyaniline |
|---|---|
| PubChem CID | 59398527 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 4-[1-[(4-methoxyphenyl)methyl]pyrazolo[3,4-b]pyridin-4-yl]oxyaniline |
| SMILES | COc1ccc(Cn2ncc3c(Oc4ccc(N)cc4)ccnc32)cc1 |
| InChI | InChI=1S/C20H18N4O2/c1-25-16-6-2-14(3-7-16)13-24-20-18(12-23-24)19(10-11-22-20)26-17-8-4-15(21)5-9-17/h2-12H,13,21H2,1H3 |
| InChIKey | ITPMMWXSWVCVFH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|