C21H18ClFN4O2 — CID 69192268
2-chloro-5-fluoro-3-[1-[(4-methoxyphenyl)methyl]-3-methylpyrazolo[3,4-b]pyridin-4-yl]oxyaniline (PubChem CID 69192268) has the molecular formula C21H18ClFN4O2 and a molecular weight of 412.85 g/mol. Its IUPAC name is 2-chloro-5-fluoro-3-[1-[(4-methoxyphenyl)methyl]-3-methylpyrazolo[3,4-b]pyridin-4-yl]oxyaniline.
| Compound Name | 2-chloro-5-fluoro-3-[1-[(4-methoxyphenyl)methyl]-3-methylpyrazolo[3,4-b]pyridin-4-yl]oxyaniline |
|---|---|
| PubChem CID | 69192268 |
| Molecular Formula | C21H18ClFN4O2 |
| Molecular Weight | 412.85 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 2-chloro-5-fluoro-3-[1-[(4-methoxyphenyl)methyl]-3-methylpyrazolo[3,4-b]pyridin-4-yl]oxyaniline |
| SMILES | COc1ccc(Cn2nc(C)c3c(Oc4cc(F)cc(N)c4Cl)ccnc32)cc1 |
| InChI | InChI=1S/C21H18ClFN4O2/c1-12-19-17(29-18-10-14(23)9-16(24)20(18)22)7-8-25-21(19)27(26-12)11-13-3-5-15(28-2)6-4-13/h3-10H,11,24H2,1-2H3 |
| InChIKey | VUDMKEDQHRZKSV-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.85 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|