C26H28FN5O4 — CID 67220824
3-fluoro-4-[1-[(4-methoxyphenyl)methyl]-3-(2-morpholin-4-ylethoxy)pyrazolo[3,4-b]pyridin-4-yl]oxyaniline (PubChem CID 67220824) has the molecular formula C26H28FN5O4 and a molecular weight of 493.54 g/mol. Its IUPAC name is 3-fluoro-4-[1-[(4-methoxyphenyl)methyl]-3-(2-morpholin-4-ylethoxy)pyrazolo[3,4-b]pyridin-4-yl]oxyaniline.
| Compound Name | 3-fluoro-4-[1-[(4-methoxyphenyl)methyl]-3-(2-morpholin-4-ylethoxy)pyrazolo[3,4-b]pyridin-4-yl]oxyaniline |
|---|---|
| PubChem CID | 67220824 |
| Molecular Formula | C26H28FN5O4 |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | 3-fluoro-4-[1-[(4-methoxyphenyl)methyl]-3-(2-morpholin-4-ylethoxy)pyrazolo[3,4-b]pyridin-4-yl]oxyaniline |
| SMILES | COc1ccc(Cn2nc(OCCN3CCOCC3)c3c(Oc4ccc(N)cc4F)ccnc32)cc1 |
| InChI | InChI=1S/C26H28FN5O4/c1-33-20-5-2-18(3-6-20)17-32-25-24(26(30-32)35-15-12-31-10-13-34-14-11-31)23(8-9-29-25)36-22-7-4-19(28)16-21(22)27/h2-9,16H,10-15,17,28H2,1H3 |
| InChIKey | HLKAMEYNTDMKAI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|