C22H25FN4O3 — CID 155779576
4-(4-amino-2-fluorophenoxy)-7-methoxy-N-(2-morpholin-4-ylethyl)quinolin-6-amine (PubChem CID 155779576) has the molecular formula C22H25FN4O3 and a molecular weight of 412.47 g/mol. Its IUPAC name is 4-(4-amino-2-fluorophenoxy)-7-methoxy-N-(2-morpholin-4-ylethyl)quinolin-6-amine.
| Compound Name | 4-(4-amino-2-fluorophenoxy)-7-methoxy-N-(2-morpholin-4-ylethyl)quinolin-6-amine |
|---|---|
| PubChem CID | 155779576 |
| Molecular Formula | C22H25FN4O3 |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 4-(4-amino-2-fluorophenoxy)-7-methoxy-N-(2-morpholin-4-ylethyl)quinolin-6-amine |
| SMILES | COc1cc2nccc(Oc3ccc(N)cc3F)c2cc1NCCN1CCOCC1 |
| InChI | InChI=1S/C22H25FN4O3/c1-28-22-14-18-16(13-19(22)26-6-7-27-8-10-29-11-9-27)20(4-5-25-18)30-21-3-2-15(24)12-17(21)23/h2-5,12-14,26H,6-11,24H2,1H3 |
| InChIKey | JFJOAKPYMVUMDF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 81.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|