C23H26FN3O4 — CID 90283838
3-fluoro-4-[6-methoxy-7-(1-morpholin-3-ylpropoxy)quinolin-4-yl]oxyaniline (PubChem CID 90283838) has the molecular formula C23H26FN3O4 and a molecular weight of 427.48 g/mol. Its IUPAC name is 3-fluoro-4-[6-methoxy-7-(1-morpholin-3-ylpropoxy)quinolin-4-yl]oxyaniline.
| Compound Name | 3-fluoro-4-[6-methoxy-7-(1-morpholin-3-ylpropoxy)quinolin-4-yl]oxyaniline |
|---|---|
| PubChem CID | 90283838 |
| Molecular Formula | C23H26FN3O4 |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 3-fluoro-4-[6-methoxy-7-(1-morpholin-3-ylpropoxy)quinolin-4-yl]oxyaniline |
| SMILES | CCC(Oc1cc2nccc(Oc3ccc(N)cc3F)c2cc1OC)C1COCCN1 |
| InChI | InChI=1S/C23H26FN3O4/c1-3-19(18-13-29-9-8-27-18)30-23-12-17-15(11-22(23)28-2)20(6-7-26-17)31-21-5-4-14(25)10-16(21)24/h4-7,10-12,18-19,27H,3,8-9,13,25H2,1-2H3 |
| InChIKey | PDXHOVBQBORISB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 87.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|