C18H18FN3O3 — CID 66669452
4-[2-(aminomethyl)-6,7-dimethoxyquinolin-4-yl]oxy-3-fluoroaniline (PubChem CID 66669452) has the molecular formula C18H18FN3O3 and a molecular weight of 343.36 g/mol. Its IUPAC name is 4-[2-(aminomethyl)-6,7-dimethoxyquinolin-4-yl]oxy-3-fluoroaniline.
| Compound Name | 4-[2-(aminomethyl)-6,7-dimethoxyquinolin-4-yl]oxy-3-fluoroaniline |
|---|---|
| PubChem CID | 66669452 |
| Molecular Formula | C18H18FN3O3 |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 4-[2-(aminomethyl)-6,7-dimethoxyquinolin-4-yl]oxy-3-fluoroaniline |
| SMILES | COc1cc2nc(CN)cc(Oc3ccc(N)cc3F)c2cc1OC |
| InChI | InChI=1S/C18H18FN3O3/c1-23-17-7-12-14(8-18(17)24-2)22-11(9-20)6-16(12)25-15-4-3-10(21)5-13(15)19/h3-8H,9,20-21H2,1-2H3 |
| InChIKey | OONZMAGVVJCGNP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|