C26H29FN6O2 — CID 68514137
4-N-[2-fluoro-2-[1-[(4-methoxyphenyl)methyl]pyrazolo[3,4-b]pyridin-4-yl]-2-morpholin-4-ylethyl]benzene-1,4-diamine (PubChem CID 68514137) has the molecular formula C26H29FN6O2 and a molecular weight of 476.56 g/mol. Its IUPAC name is 4-N-[2-fluoro-2-[1-[(4-methoxyphenyl)methyl]pyrazolo[3,4-b]pyridin-4-yl]-2-morpholin-4-ylethyl]benzene-1,4-diamine.
| Compound Name | 4-N-[2-fluoro-2-[1-[(4-methoxyphenyl)methyl]pyrazolo[3,4-b]pyridin-4-yl]-2-morpholin-4-ylethyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 68514137 |
| Molecular Formula | C26H29FN6O2 |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | 4-N-[2-fluoro-2-[1-[(4-methoxyphenyl)methyl]pyrazolo[3,4-b]pyridin-4-yl]-2-morpholin-4-ylethyl]benzene-1,4-diamine |
| SMILES | COc1ccc(Cn2ncc3c(C(F)(CNc4ccc(N)cc4)N4CCOCC4)ccnc32)cc1 |
| InChI | InChI=1S/C26H29FN6O2/c1-34-22-8-2-19(3-9-22)17-33-25-23(16-31-33)24(10-11-29-25)26(27,32-12-14-35-15-13-32)18-30-21-6-4-20(28)5-7-21/h2-11,16,30H,12-15,17-18,28H2,1H3 |
| InChIKey | MAXOOZFHEGCVPS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|