C25H20F5N3O4 — CID 169006823
6-[[3,5-difluoro-4-[3-(trifluoromethoxy)phenoxy]phenyl]methoxy]-3,5,9-triazatetracyclo[8.2.2.01,9.03,8]tetradeca-5,7-dien-4-one (PubChem CID 169006823) has the molecular formula C25H20F5N3O4 and a molecular weight of 521.44 g/mol. Its IUPAC name is 6-[[3,5-difluoro-4-[3-(trifluoromethoxy)phenoxy]phenyl]methoxy]-3,5,9-triazatetracyclo[8.2.2.01,9.03,8]tetradeca-5,7-dien-4-one.
| Compound Name | 6-[[3,5-difluoro-4-[3-(trifluoromethoxy)phenoxy]phenyl]methoxy]-3,5,9-triazatetracyclo[8.2.2.01,9.03,8]tetradeca-5,7-dien-4-one |
|---|---|
| PubChem CID | 169006823 |
| Molecular Formula | C25H20F5N3O4 |
| Molecular Weight | 521.44 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | 6-[[3,5-difluoro-4-[3-(trifluoromethoxy)phenoxy]phenyl]methoxy]-3,5,9-triazatetracyclo[8.2.2.01,9.03,8]tetradeca-5,7-dien-4-one |
| SMILES | O=c1nc(OCc2cc(F)c(Oc3cccc(OC(F)(F)F)c3)c(F)c2)cc2n1CC13CCC(CC1)N23 |
| InChI | InChI=1S/C25H20F5N3O4/c26-18-8-14(9-19(27)22(18)36-16-2-1-3-17(10-16)37-25(28,29)30)12-35-20-11-21-32(23(34)31-20)13-24-6-4-15(5-7-24)33(21)24/h1-3,8-11,15H,4-7,12-13H2 |
| InChIKey | IXCGZSLZHBXUCD-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.44 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |