C23H18F5N3O3 — CID 118685981
11-[[3,5-difluoro-4-[3-(trifluoromethyl)phenoxy]phenyl]methoxy]-2,8,10-triazatricyclo[6.4.0.02,6]dodeca-1(12),10-dien-9-one (PubChem CID 118685981) has the molecular formula C23H18F5N3O3 and a molecular weight of 479.41 g/mol. Its IUPAC name is 11-[[3,5-difluoro-4-[3-(trifluoromethyl)phenoxy]phenyl]methoxy]-2,8,10-triazatricyclo[6.4.0.02,6]dodeca-1(12),10-dien-9-one.
| Compound Name | 11-[[3,5-difluoro-4-[3-(trifluoromethyl)phenoxy]phenyl]methoxy]-2,8,10-triazatricyclo[6.4.0.02,6]dodeca-1(12),10-dien-9-one |
|---|---|
| PubChem CID | 118685981 |
| Molecular Formula | C23H18F5N3O3 |
| Molecular Weight | 479.41 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | 11-[[3,5-difluoro-4-[3-(trifluoromethyl)phenoxy]phenyl]methoxy]-2,8,10-triazatricyclo[6.4.0.02,6]dodeca-1(12),10-dien-9-one |
| SMILES | O=c1nc(OCc2cc(F)c(Oc3cccc(C(F)(F)F)c3)c(F)c2)cc2n1CC1CCCN21 |
| InChI | InChI=1S/C23H18F5N3O3/c24-17-7-13(8-18(25)21(17)34-16-5-1-3-14(9-16)23(26,27)28)12-33-19-10-20-30-6-2-4-15(30)11-31(20)22(32)29-19/h1,3,5,7-10,15H,2,4,6,11-12H2 |
| InChIKey | CIOMXUBNOXKHAF-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.41 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |