C22H23F5N4O3 — CID 118686366
11-[[3,5-difluoro-4-[1-(3,3,3-trifluoropropyl)azetidin-3-yl]oxyphenyl]methoxy]-2,8,10-triazatricyclo[6.4.0.02,6]dodeca-1(12),10-dien-9-one (PubChem CID 118686366) has the molecular formula C22H23F5N4O3 and a molecular weight of 486.44 g/mol. Its IUPAC name is 11-[[3,5-difluoro-4-[1-(3,3,3-trifluoropropyl)azetidin-3-yl]oxyphenyl]methoxy]-2,8,10-triazatricyclo[6.4.0.02,6]dodeca-1(12),10-dien-9-one.
| Compound Name | 11-[[3,5-difluoro-4-[1-(3,3,3-trifluoropropyl)azetidin-3-yl]oxyphenyl]methoxy]-2,8,10-triazatricyclo[6.4.0.02,6]dodeca-1(12),10-dien-9-one |
|---|---|
| PubChem CID | 118686366 |
| Molecular Formula | C22H23F5N4O3 |
| Molecular Weight | 486.44 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 11-[[3,5-difluoro-4-[1-(3,3,3-trifluoropropyl)azetidin-3-yl]oxyphenyl]methoxy]-2,8,10-triazatricyclo[6.4.0.02,6]dodeca-1(12),10-dien-9-one |
| SMILES | O=c1nc(OCc2cc(F)c(OC3CN(CCC(F)(F)F)C3)c(F)c2)cc2n1CC1CCCN21 |
| InChI | InChI=1S/C22H23F5N4O3/c23-16-6-13(7-17(24)20(16)34-15-10-29(11-15)5-3-22(25,26)27)12-33-18-8-19-30-4-1-2-14(30)9-31(19)21(32)28-18/h6-8,14-15H,1-5,9-12H2 |
| InChIKey | UMPICCYPQGQBNB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 59.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |