C51H30N4OS — CID 169010921
9-[7-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]dibenzothiophen-1-yl]carbazole (PubChem CID 169010921) has the molecular formula C51H30N4OS and a molecular weight of 746.90 g/mol. Its IUPAC name is 9-[7-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]dibenzothiophen-1-yl]carbazole.
| Compound Name | 9-[7-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]dibenzothiophen-1-yl]carbazole |
|---|---|
| PubChem CID | 169010921 |
| Molecular Formula | C51H30N4OS |
| Molecular Weight | 746.90 g/mol |
| Exact Mass | 746.21 |
| IUPAC Name | 9-[7-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]dibenzothiophen-1-yl]carbazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4c(c3)oc3ccc(-c5ccc6c(c5)sc5cccc(-n7c8ccccc8c8ccccc87)c56)cc34)n2)cc1 |
| InChI | InChI=1S/C51H30N4OS/c1-3-12-31(13-4-1)49-52-50(32-14-5-2-6-15-32)54-51(53-49)35-23-25-38-40-28-33(24-27-44(40)56-45(38)29-35)34-22-26-39-47(30-34)57-46-21-11-20-43(48(39)46)55-41-18-9-7-16-36(41)37-17-8-10-19-42(37)55/h1-30H |
| InChIKey | DANGSCJMHAPVCS-UHFFFAOYSA-N |
| XLogP | 13.90 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.90 |
| LogP ≤ 5 | 13.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |