C30H24FO4S+ — CID 169017199
2-(4-fluorophenyl)propan-2-yl 2-[4-(9-oxothioxanthen-10-ium-10-yl)phenoxy]acetate (PubChem CID 169017199) has the molecular formula C30H24FO4S+ and a molecular weight of 499.58 g/mol. Its IUPAC name is 2-(4-fluorophenyl)propan-2-yl 2-[4-(9-oxothioxanthen-10-ium-10-yl)phenoxy]acetate.
| Compound Name | 2-(4-fluorophenyl)propan-2-yl 2-[4-(9-oxothioxanthen-10-ium-10-yl)phenoxy]acetate |
|---|---|
| PubChem CID | 169017199 |
| Molecular Formula | C30H24FO4S+ |
| Molecular Weight | 499.58 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | 2-(4-fluorophenyl)propan-2-yl 2-[4-(9-oxothioxanthen-10-ium-10-yl)phenoxy]acetate |
| SMILES | CC(C)(OC(=O)COc1ccc(-[s+]2c3ccccc3c(=O)c3ccccc32)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C30H24FO4S/c1-30(2,20-11-13-21(31)14-12-20)35-28(32)19-34-22-15-17-23(18-16-22)36-26-9-5-3-7-24(26)29(33)25-8-4-6-10-27(25)36/h3-18H,19H2,1-2H3/q+1 |
| InChIKey | KKHOFGOQKMOYLA-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.58 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|