C14H30N2O — CID 169017959
(6,6-ditert-butyl-1,4-oxazepan-2-yl)methanamine (PubChem CID 169017959) has the molecular formula C14H30N2O and a molecular weight of 242.41 g/mol. Its IUPAC name is (6,6-ditert-butyl-1,4-oxazepan-2-yl)methanamine.
| Compound Name | (6,6-ditert-butyl-1,4-oxazepan-2-yl)methanamine |
|---|---|
| PubChem CID | 169017959 |
| Molecular Formula | C14H30N2O |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | (6,6-ditert-butyl-1,4-oxazepan-2-yl)methanamine |
| SMILES | CC(C)(C)C1(C(C)(C)C)CNCC(CN)OC1 |
| InChI | InChI=1S/C14H30N2O/c1-12(2,3)14(13(4,5)6)9-16-8-11(7-15)17-10-14/h11,16H,7-10,15H2,1-6H3 |
| InChIKey | QVBLUZKXDDUVBU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |