C11H21NO — CID 130847158
6-(2-cyclopropylethyl)-2,2-dimethylmorpholine (PubChem CID 130847158) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is 6-(2-cyclopropylethyl)-2,2-dimethylmorpholine.
| Compound Name | 6-(2-cyclopropylethyl)-2,2-dimethylmorpholine |
|---|---|
| PubChem CID | 130847158 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 6-(2-cyclopropylethyl)-2,2-dimethylmorpholine |
| SMILES | CC1(C)CNCC(CCC2CC2)O1 |
| InChI | InChI=1S/C11H21NO/c1-11(2)8-12-7-10(13-11)6-5-9-3-4-9/h9-10,12H,3-8H2,1-2H3 |
| InChIKey | DEAAOIIGGRCMGA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |