C12H26N2O2 — CID 114775638
3-[(6,6-dimethylmorpholin-2-yl)methoxy]-N,N-dimethylpropan-1-amine (PubChem CID 114775638) has the molecular formula C12H26N2O2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 3-[(6,6-dimethylmorpholin-2-yl)methoxy]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[(6,6-dimethylmorpholin-2-yl)methoxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 114775638 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 3-[(6,6-dimethylmorpholin-2-yl)methoxy]-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCOCC1CNCC(C)(C)O1 |
| InChI | InChI=1S/C12H26N2O2/c1-12(2)10-13-8-11(16-12)9-15-7-5-6-14(3)4/h11,13H,5-10H2,1-4H3 |
| InChIKey | XNWDXYDHCBHONS-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|