C13H27NO3 — CID 114775589
2,2-dimethyl-6-[2-[(2-methylpropan-2-yl)oxy]ethoxymethyl]morpholine (PubChem CID 114775589) has the molecular formula C13H27NO3 and a molecular weight of 245.36 g/mol. Its IUPAC name is 2,2-dimethyl-6-[2-[(2-methylpropan-2-yl)oxy]ethoxymethyl]morpholine.
| Compound Name | 2,2-dimethyl-6-[2-[(2-methylpropan-2-yl)oxy]ethoxymethyl]morpholine |
|---|---|
| PubChem CID | 114775589 |
| Molecular Formula | C13H27NO3 |
| Molecular Weight | 245.36 g/mol |
| Exact Mass | 245.20 |
| IUPAC Name | 2,2-dimethyl-6-[2-[(2-methylpropan-2-yl)oxy]ethoxymethyl]morpholine |
| SMILES | CC(C)(C)OCCOCC1CNCC(C)(C)O1 |
| InChI | InChI=1S/C13H27NO3/c1-12(2,3)16-7-6-15-9-11-8-14-10-13(4,5)17-11/h11,14H,6-10H2,1-5H3 |
| InChIKey | RHYNDAZUZDVFSA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|