C12H22N2O3 — CID 114775458
2-[(6,6-dimethylmorpholin-2-yl)methoxy]-N-prop-2-enylacetamide (PubChem CID 114775458) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is 2-[(6,6-dimethylmorpholin-2-yl)methoxy]-N-prop-2-enylacetamide.
| Compound Name | 2-[(6,6-dimethylmorpholin-2-yl)methoxy]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 114775458 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 2-[(6,6-dimethylmorpholin-2-yl)methoxy]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)COCC1CNCC(C)(C)O1 |
| InChI | InChI=1S/C12H22N2O3/c1-4-5-14-11(15)8-16-7-10-6-13-9-12(2,3)17-10/h4,10,13H,1,5-9H2,2-3H3,(H,14,15) |
| InChIKey | YHHXWVMLZJETPA-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|