C24H23N5O2 — CID 169018032
2-[5-[(4-benzoylphenyl)methylamino]-3-methylpyrazol-1-yl]-4-ethyl-1H-pyrimidin-6-one (PubChem CID 169018032) has the molecular formula C24H23N5O2 and a molecular weight of 413.48 g/mol. Its IUPAC name is 2-[5-[(4-benzoylphenyl)methylamino]-3-methylpyrazol-1-yl]-4-ethyl-1H-pyrimidin-6-one.
| Compound Name | 2-[5-[(4-benzoylphenyl)methylamino]-3-methylpyrazol-1-yl]-4-ethyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 169018032 |
| Molecular Formula | C24H23N5O2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 2-[5-[(4-benzoylphenyl)methylamino]-3-methylpyrazol-1-yl]-4-ethyl-1H-pyrimidin-6-one |
| SMILES | CCc1cc(=O)[nH]c(-n2nc(C)cc2NCc2ccc(C(=O)c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C24H23N5O2/c1-3-20-14-22(30)27-24(26-20)29-21(13-16(2)28-29)25-15-17-9-11-19(12-10-17)23(31)18-7-5-4-6-8-18/h4-14,25H,3,15H2,1-2H3,(H,26,27,30) |
| InChIKey | MVSGHQYFYNTDMH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |