C52H47N4OPdSi-3 — CID 169019088
2-(5,5-dibutyl-10-pyridin-2-ylbenzo[b][1]benzosilin-10-yl)-10-[3-(3-methyl-2H-benzimidazol-2-id-1-yl)benzene-2-id-1-yl]-1H-phenoxazin-1-ide;palladium (PubChem CID 169019088) has the molecular formula C52H47N4OPdSi-3 and a molecular weight of 878.48 g/mol. Its IUPAC name is 2-(5,5-dibutyl-10-pyridin-2-ylbenzo[b][1]benzosilin-10-yl)-10-[3-(3-methyl-2H-benzimidazol-2-id-1-yl)benzene-2-id-1-yl]-1H-phenoxazin-1-ide;palladium.
| Compound Name | 2-(5,5-dibutyl-10-pyridin-2-ylbenzo[b][1]benzosilin-10-yl)-10-[3-(3-methyl-2H-benzimidazol-2-id-1-yl)benzene-2-id-1-yl]-1H-phenoxazin-1-ide;palladium |
|---|---|
| PubChem CID | 169019088 |
| Molecular Formula | C52H47N4OPdSi-3 |
| Molecular Weight | 878.48 g/mol |
| Exact Mass | 877.26 |
| IUPAC Name | 2-(5,5-dibutyl-10-pyridin-2-ylbenzo[b][1]benzosilin-10-yl)-10-[3-(3-methyl-2H-benzimidazol-2-id-1-yl)benzene-2-id-1-yl]-1H-phenoxazin-1-ide;palladium |
| SMILES | CCCC[Si]1(CCCC)c2ccccc2C(c2[c-]c3c(cc2)Oc2ccccc2N3c2[c-]c(N3[CH-]N(C)c4ccccc43)ccc2)(c2ccccn2)c2ccccc21.[Pd] |
| InChI | InChI=1S/C52H47N4OSi.Pd/c1-4-6-33-58(34-7-5-2)49-27-14-8-21-41(49)52(51-29-16-17-32-53-51,42-22-9-15-28-50(42)58)38-30-31-48-46(35-38)56(45-25-12-13-26-47(45)57-48)40-20-18-19-39(36-40)55-37-54(3)43-23-10-11-24-44(43)55;/h8-32,37H,4-7,33-34H2,1-3H3;/q-3; |
| InChIKey | ROPMTMYGLSSTSD-UHFFFAOYSA-N |
| XLogP | 11.82 |
| TPSA | 31.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.48 |
| LogP ≤ 5 | 11.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|