C62H40B2N8O4Pt2 — CID 169292638
CID 169292638 (PubChem CID 169292638) has the molecular formula C62H40B2N8O4Pt2 and a molecular weight of 1372.83 g/mol.
| Compound Name | CID 169292638 |
|---|---|
| PubChem CID | 169292638 |
| Molecular Formula | C62H40B2N8O4Pt2 |
| Molecular Weight | 1372.83 g/mol |
| Exact Mass | 1372.27 |
| IUPAC Name | — |
| SMILES | CN1[CH-]N(c2[c-]c3c(cc2)Oc2c4c5c(c6c2B3c2[c-]c(N3[CH-]N(C)c7ccccc73)ccc2O6)Oc2ccc(N3[CH-]N(C)c6ccccc63)[c-]c2B5c2[c-]c(N3[CH-]N(C)c5ccccc53)ccc2O4)c2ccccc21.[Pt+4].[Pt+4] |
| InChI | InChI=1S/C62H40B2N8O4.2Pt/c1-65-33-69(49-17-9-5-13-45(49)65)37-21-25-53-41(29-37)63-42-30-38(70-34-66(2)46-14-6-10-18-50(46)70)22-26-54(42)74-60-57(63)59(73-53)61-58-62(60)76-56-28-24-40(72-36-68(4)48-16-8-12-20-52(48)72)32-44(56)64(58)43-31-39(23-27-55(43)75-61)71-35-67(3)47-15-7-11-19-51(47)71;;/h5-28,33-36H,1-4H3;;/q-8;2*+4 |
| InChIKey | XHNQRRHREIJRTP-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 62.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1372.83 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|