About CID 169292634
CID 169292634 (PubChem CID 169292634) has the molecular formula C46H30B2N8O4Pt2-6
and a molecular weight of 1170.58 g/mol.
Molecular Properties
| Compound Name | CID 169292634 |
| PubChem CID | 169292634 |
| Molecular Formula | C46H30B2N8O4Pt2-6 |
| Molecular Weight | 1170.58 g/mol |
| Exact Mass | 1170.19 |
| IUPAC Name | — |
| SMILES | CN1C=CN(c2[c-]c3c(cc2)Oc2c4c5c(c6c2B3c2[c-]c(-c3nccn3C)ccc2O6)Oc2ccc(-c3nccn3C)[c-]c2B5c2[c-]c(N3C=CN(C)[CH-]3)ccc2O4)[CH-]1.[Pt].[Pt] |
| InChI | InChI=1S/C46H30B2N8O4.2Pt/c1-51-17-19-55(25-51)29-7-11-37-33(23-29)47-31-21-27(45-49-13-15-53(45)3)5-9-35(31)57-41-39(47)43(59-37)44-40-42(41)58-36-10-6-28(46-50-14-16-54(46)4)22-32(36)48(40)34-24-30(8-12-38(34)60-44)56-20-18-52(2)26-56;;/h5-20,25-26H,1-4H3;;/q-6;; |
| InChIKey | DQTSRUOBHCDHLP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 85.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 62 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1170.58 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 169292634 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 169292634?
The IUPAC name of CID 169292634 (CID 169292634) is not available.
What is the SMILES notation for CID 169292634?
The canonical SMILES for CID 169292634 is CN1C=CN(c2[c-]c3c(cc2)Oc2c4c5c(c6c2B3c2[c-]c(-c3nccn3C)ccc2O6)Oc2ccc(-c3nccn3C)[c-]c2B5c2[c-]c(N3C=CN(C)[CH-]3)ccc2O4)[CH-]1.[Pt].[Pt].
What is the InChIKey of CID 169292634?
The InChIKey is DQTSRUOBHCDHLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C46H30B2N8O4.2Pt/c1-51-17-19-55(25-51)29-7-11-37-33(23-29)47-31-21-27(45-49-13-15-53(45)3)5-9-35(31)57-41-39(47)43(59-37)44-40-42(41)58-36-10-6-28(46-50-14-16-54(46)4)22-32(36)48(40)34-24-30(8-12-38(34)60-44)56-20-18-52(2)26-56;;/h5-20,25-26H,1-4H3;;/q-6;;.
What are the key properties of CID 169292634?
CID 169292634 has a molecular weight of 1170.58 g/mol, XLogP of 3.82, 4 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 169292634 is sourced from PubChem (CID 169292634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).