C44H26B2N10Pt2S4 — CID 169292635
CID 169292635 (PubChem CID 169292635) has the molecular formula C44H26B2N10Pt2S4 and a molecular weight of 1234.81 g/mol.
| Compound Name | CID 169292635 |
|---|---|
| PubChem CID | 169292635 |
| Molecular Formula | C44H26B2N10Pt2S4 |
| Molecular Weight | 1234.81 g/mol |
| Exact Mass | 1234.07 |
| IUPAC Name | — |
| SMILES | Cn1ccnc1-c1[c-]c2c(cc1)Sc1c3c4c(c5c1B2c1[c-]c(-c2nccn2C)cnc1S5)Sc1ncc(-c2nccn2C)[c-]c1B4c1[c-]c(-c2nccn2C)ccc1S3.[Pt+2].[Pt+2] |
| InChI | InChI=1S/C44H26B2N10S4.2Pt/c1-53-13-9-47-39(53)23-5-7-31-27(17-23)45-29-19-25(41-49-11-15-55(41)3)21-51-43(29)59-37-33(45)35(57-31)36-34-38(37)60-44-30(20-26(22-52-44)42-50-12-16-56(42)4)46(34)28-18-24(6-8-32(28)58-36)40-48-10-14-54(40)2;;/h5-16,21-22H,1-4H3;;/q-4;2*+2 |
| InChIKey | NZHRIKUQYJTRHL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 97.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1234.81 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|