About CID 169292617
CID 169292617 (PubChem CID 169292617) has the molecular formula C46H28B2N8Pt2S4
and a molecular weight of 1232.83 g/mol.
Molecular Properties
| Compound Name | CID 169292617 |
| PubChem CID | 169292617 |
| Molecular Formula | C46H28B2N8Pt2S4 |
| Molecular Weight | 1232.83 g/mol |
| Exact Mass | 1232.08 |
| IUPAC Name | — |
| SMILES | Cn1ccnc1-c1[c-]c2c(cc1)Sc1c3c4c(c5c1B2c1[c-]c(-c2nccn2C)ccc1S5)Sc1ccc(-c2nccn2C)[c-]c1B4c1[c-]c(-c2nccn2C)ccc1S3.[Pt+2].[Pt+2] |
| InChI | InChI=1S/C46H28B2N8S4.2Pt/c1-53-17-13-49-43(53)25-5-9-33-29(21-25)47-30-22-26(44-50-14-18-54(44)2)6-10-34(30)58-40-37(47)39(57-33)41-38-42(40)60-36-12-8-28(46-52-16-20-56(46)4)24-32(36)48(38)31-23-27(7-11-35(31)59-41)45-51-15-19-55(45)3;;/h5-20H,1-4H3;;/q-4;2*+2 |
| InChIKey | CEWFTZSSKNMQLC-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 71.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 62 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1232.83 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 169292617 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 169292617?
The IUPAC name of CID 169292617 (CID 169292617) is not available.
What is the SMILES notation for CID 169292617?
The canonical SMILES for CID 169292617 is Cn1ccnc1-c1[c-]c2c(cc1)Sc1c3c4c(c5c1B2c1[c-]c(-c2nccn2C)ccc1S5)Sc1ccc(-c2nccn2C)[c-]c1B4c1[c-]c(-c2nccn2C)ccc1S3.[Pt+2].[Pt+2].
What is the InChIKey of CID 169292617?
The InChIKey is CEWFTZSSKNMQLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C46H28B2N8S4.2Pt/c1-53-17-13-49-43(53)25-5-9-33-29(21-25)47-30-22-26(44-50-14-18-54(44)2)6-10-34(30)58-40-37(47)39(57-33)41-38-42(40)60-36-12-8-28(46-52-16-20-56(46)4)24-32(36)48(38)31-23-27(7-11-35(31)59-41)45-51-15-19-55(45)3;;/h5-20H,1-4H3;;/q-4;2*+2.
What are the key properties of CID 169292617?
CID 169292617 has a molecular weight of 1232.83 g/mol, XLogP of 5.38, 4 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 169292617 is sourced from PubChem (CID 169292617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).